C26H40O4 — CID 21118263
[(8S,9S,10S,13S,14S)-2,10,13-trimethyl-1-propanoyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] propanoate (PubChem CID 21118263) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S)-2,10,13-trimethyl-1-propanoyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] propanoate.
| Compound Name | [(8S,9S,10S,13S,14S)-2,10,13-trimethyl-1-propanoyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] propanoate |
|---|---|
| PubChem CID | 21118263 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(8S,9S,10S,13S,14S)-2,10,13-trimethyl-1-propanoyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] propanoate |
| SMILES | CCC(=O)OC1(OC(=O)CC)C(C)=CCC2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C26H40O4/c1-6-22(27)29-26(30-23(28)7-2)17(3)10-11-18-12-13-19-20-9-8-15-24(20,4)16-14-21(19)25(18,26)5/h10,18-21H,6-9,11-16H2,1-5H3/t18?,19-,20-,21-,24-,25-/m0/s1 |
| InChIKey | HKDTVCAQNSAFSJ-ZJYXOQQXSA-N |
| XLogP | 6.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|