C21H32O3 — CID 50925604
[(2S,4R,6R,8S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-6-yl] acetate (PubChem CID 50925604) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(2S,4R,6R,8S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-6-yl] acetate.
| Compound Name | [(2S,4R,6R,8S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-6-yl] acetate |
|---|---|
| PubChem CID | 50925604 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(2S,4R,6R,8S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-6-yl] acetate |
| SMILES | CC(=O)O[C@]12C[C@@H]3CCC4C(CC[C@]5(C)CCC[C@@H]45)[C@@]3(C)C[C@H]1O2 |
| InChI | InChI=1S/C21H32O3/c1-13(22)23-21-11-14-6-7-15-16-5-4-9-19(16,2)10-8-17(15)20(14,3)12-18(21)24-21/h14-18H,4-12H2,1-3H3/t14-,15?,16-,17?,18+,19-,20-,21-/m0/s1 |
| InChIKey | OXTRKYJDMLCQJI-FYLQMURDSA-N |
| XLogP | 4.69 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|