C32H48 — CID 143879885
1,2-dimethylcyclohexa-1,3-diene;prop-1-ene;10,13,17-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene (PubChem CID 143879885) has the molecular formula C32H48 and a molecular weight of 432.74 g/mol. Its IUPAC name is 1,2-dimethylcyclohexa-1,3-diene;prop-1-ene;10,13,17-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 1,2-dimethylcyclohexa-1,3-diene;prop-1-ene;10,13,17-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143879885 |
| Molecular Formula | C32H48 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.38 |
| IUPAC Name | 1,2-dimethylcyclohexa-1,3-diene;prop-1-ene;10,13,17-trimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=C2CCC3C4CC=C(C)C4(C)CCC3C2(C)CC1.C=CC.CC1=C(C)CCC=C1 |
| InChI | InChI=1S/C21H30.C8H12.C3H6/c1-14-9-11-21(4)16(13-14)6-7-17-18-8-5-15(2)20(18,3)12-10-19(17)21;1-7-5-3-4-6-8(7)2;1-3-2/h5,13,17-19H,1,6-12H2,2-4H3;3,5H,4,6H2,1-2H3;3H,1H2,2H3 |
| InChIKey | MQXXWXNMHQKLPL-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|