C23H33NO2 — CID 168883828
[(E)-1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino] formate (PubChem CID 168883828) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is [(E)-1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino] formate.
| Compound Name | [(E)-1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino] formate |
|---|---|
| PubChem CID | 168883828 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | [(E)-1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino] formate |
| SMILES | C=C1C=C2CCC3C(CCC4(C)C(/C(C)=N/OC=O)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C23H33NO2/c1-15-9-11-22(3)17(13-15)5-6-18-20-8-7-19(16(2)24-26-14-25)23(20,4)12-10-21(18)22/h13-14,18-21H,1,5-12H2,2-4H3/b24-16+ |
| InChIKey | YOOILXINQBKIHY-LFVJCYFKSA-N |
| XLogP | 5.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|