C23H37N — CID 168883920
1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-N-methylethanamine (PubChem CID 168883920) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-N-methylethanamine.
| Compound Name | 1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 168883920 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 1-(10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-N-methylethanamine |
| SMILES | C=C1C=C2CCC3C(CCC4(C)C(C(C)NC)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C23H37N/c1-15-10-12-22(3)17(14-15)6-7-18-20-9-8-19(16(2)24-5)23(20,4)13-11-21(18)22/h14,16,18-21,24H,1,6-13H2,2-5H3 |
| InChIKey | RQGYIBOOMRELAT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |