C27H33FO5 — CID 56605787
(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56605787) has the molecular formula C27H33FO5 and a molecular weight of 456.55 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56605787 |
| Molecular Formula | C27H33FO5 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](O)[C@@]3(F)[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CCC2(O)C1(Oc2ccccc2)CO1 |
| InChI | InChI=1S/C27H33FO5/c1-23-12-10-18(29)14-17(23)8-9-21-20-11-13-25(31,24(20,2)15-22(30)27(21,23)28)26(16-32-26)33-19-6-4-3-5-7-19/h3-7,14,20-22,30-31H,8-13,15-16H2,1-2H3/t20-,21-,22-,23-,24-,25?,26?,27-/m0/s1 |
| InChIKey | QIFIHVUAIBHDAX-AOTBMUEDSA-N |
| XLogP | 4.12 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|