C26H38NO5+ — CID 11871647
[2-[2-[(8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-2-oxoethyl]-trimethylazanium (PubChem CID 11871647) has the molecular formula C26H38NO5+ and a molecular weight of 444.59 g/mol. Its IUPAC name is [2-[2-[(8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[2-[(8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 11871647 |
| Molecular Formula | C26H38NO5+ |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [2-[2-[(8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-2-oxoethyl]-trimethylazanium |
| SMILES | C[C@]12CC[C@H]3[C@H](CCC4=CC(=O)C=C[C@]43C)[C@@H]1CC[C@]2(O)C(=O)COC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C26H38NO5/c1-24-11-8-18(28)14-17(24)6-7-19-20(24)9-12-25(2)21(19)10-13-26(25,31)22(29)16-32-23(30)15-27(3,4)5/h8,11,14,19-21,31H,6-7,9-10,12-13,15-16H2,1-5H3/q+1/t19-,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | LTNKVLZWZNPXCS-ODKAPRIQSA-N |
| XLogP | 2.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|