C28H31NO7 — CID 125029039
[2-[(8S,9R,10S,13R,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 125029039) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13R,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[(8S,9R,10S,13R,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 125029039 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | [2-[(8S,9R,10S,13R,14R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | C[C@@]12C=CC(=O)C=C1CC[C@H]1[C@H]2CC[C@]2(C)[C@@H]1CC[C@@]2(O)C(=O)COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H31NO7/c1-26-12-9-20(30)15-18(26)5-8-21-22(26)10-13-27(2)23(21)11-14-28(27,33)24(31)16-36-25(32)17-3-6-19(7-4-17)29(34)35/h3-4,6-7,9,12,15,21-23,33H,5,8,10-11,13-14,16H2,1-2H3/t21-,22+,23+,26+,27+,28+/m0/s1 |
| InChIKey | IUGRRACPSNBQRS-HYHJDXDTSA-N |
| XLogP | 4.36 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|