C23H29BrO5 — CID 137469324
[2-[(10R,13S,17R)-6-bromo-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 137469324) has the molecular formula C23H29BrO5 and a molecular weight of 465.38 g/mol. Its IUPAC name is [2-[(10R,13S,17R)-6-bromo-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(10R,13S,17R)-6-bromo-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 137469324 |
| Molecular Formula | C23H29BrO5 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [2-[(10R,13S,17R)-6-bromo-17-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CCC2C3CC(Br)C4=CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H29BrO5/c1-13(25)29-12-20(27)23(28)9-6-17-15-11-19(24)18-10-14(26)4-7-21(18,2)16(15)5-8-22(17,23)3/h4,7,10,15-17,19,28H,5-6,8-9,11-12H2,1-3H3/t15?,16?,17?,19?,21-,22+,23+/m1/s1 |
| InChIKey | FLQIMGRQPNMSCP-JMFZUUJZSA-N |
| XLogP | 3.53 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|