C23H28Br2O6 — CID 70564544
[2-[(8S,9S,10R,11S,13S,14S,17R)-6,7-dibromo-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70564544) has the molecular formula C23H28Br2O6 and a molecular weight of 560.28 g/mol. Its IUPAC name is [2-[(8S,9S,10R,11S,13S,14S,17R)-6,7-dibromo-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-6,7-dibromo-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70564544 |
| Molecular Formula | C23H28Br2O6 |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-6,7-dibromo-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C(Br)C(Br)C4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H28Br2O6/c1-11(26)31-10-16(29)23(30)7-5-13-17-18(15(28)9-22(13,23)3)21(2)6-4-12(27)8-14(21)19(24)20(17)25/h4,6,8,13,15,17-20,28,30H,5,7,9-10H2,1-3H3/t13-,15-,17-,18-,19?,20?,21-,22-,23-/m0/s1 |
| InChIKey | POGOPVLMGVIVHC-WIZWZXTRSA-N |
| XLogP | 2.88 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|