C26H29NO5 — CID 171394444
[(8R,9S,10R,13S,14S,17R)-16,16,17-trideuterio-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrobenzoate (PubChem CID 171394444) has the molecular formula C26H29NO5 and a molecular weight of 438.54 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-16,16,17-trideuterio-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrobenzoate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-16,16,17-trideuterio-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 171394444 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-16,16,17-trideuterio-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrobenzoate |
| SMILES | [2H]C1([2H])C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]2(C)[C@]1([2H])OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29NO5/c1-25-13-11-19(28)15-17(25)5-8-20-21-9-10-23(26(21,2)14-12-22(20)25)32-24(29)16-3-6-18(7-4-16)27(30)31/h3-4,6-7,11,13,15,20-23H,5,8-10,12,14H2,1-2H3/t20-,21-,22-,23+,25-,26-/m0/s1/i10D2,23D |
| InChIKey | FPMWLSVHKYQHAI-YXZOSJEDSA-N |
| XLogP | 5.43 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|