C15H23O5P — CID 102574215
[(8aS)-8a-methyl-6-oxo-3,4,7,8-tetrahydronaphthalen-1-yl] diethyl phosphate (PubChem CID 102574215) has the molecular formula C15H23O5P and a molecular weight of 314.32 g/mol. Its IUPAC name is [(8aS)-8a-methyl-6-oxo-3,4,7,8-tetrahydronaphthalen-1-yl] diethyl phosphate.
| Compound Name | [(8aS)-8a-methyl-6-oxo-3,4,7,8-tetrahydronaphthalen-1-yl] diethyl phosphate |
|---|---|
| PubChem CID | 102574215 |
| Molecular Formula | C15H23O5P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(8aS)-8a-methyl-6-oxo-3,4,7,8-tetrahydronaphthalen-1-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CCCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C15H23O5P/c1-4-18-21(17,19-5-2)20-14-8-6-7-12-11-13(16)9-10-15(12,14)3/h8,11H,4-7,9-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | PULJZFZRALWFSJ-HNNXBMFYSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|