C22H26O2 — CID 59086393
(5R)-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-8,16-dione (PubChem CID 59086393) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (5R)-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-8,16-dione.
| Compound Name | (5R)-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-8,16-dione |
|---|---|
| PubChem CID | 59086393 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (5R)-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-8,16-dione |
| SMILES | CC12CCC(=O)C=C1CCC1=C2CCC23C(=O)CC[C@]2(C)CC=C13 |
| InChI | InChI=1S/C22H26O2/c1-20-9-6-18-16-4-3-14-13-15(23)5-11-21(14,2)17(16)7-12-22(18,20)19(24)8-10-20/h6,13H,3-5,7-12H2,1-2H3/t20-,21?,22?/m0/s1 |
| InChIKey | QWOYEUURJRKUDO-HWELCPFYSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |