C23H26O2 — CID 59086354
(5R,9R)-5,13-dimethylhexacyclo[10.9.0.02,9.05,9.013,18.019,21]henicosa-1(12),2,17-triene-8,16-dione (PubChem CID 59086354) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (5R,9R)-5,13-dimethylhexacyclo[10.9.0.02,9.05,9.013,18.019,21]henicosa-1(12),2,17-triene-8,16-dione.
| Compound Name | (5R,9R)-5,13-dimethylhexacyclo[10.9.0.02,9.05,9.013,18.019,21]henicosa-1(12),2,17-triene-8,16-dione |
|---|---|
| PubChem CID | 59086354 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (5R,9R)-5,13-dimethylhexacyclo[10.9.0.02,9.05,9.013,18.019,21]henicosa-1(12),2,17-triene-8,16-dione |
| SMILES | CC12CCC(=O)C=C1C1CC1C1=C2CC[C@@]23C(=O)CC[C@]2(C)CC=C13 |
| InChI | InChI=1S/C23H26O2/c1-21-7-4-17-20-15-12-14(15)18-11-13(24)3-9-22(18,2)16(20)5-10-23(17,21)19(25)6-8-21/h4,11,14-15H,3,5-10,12H2,1-2H3/t14?,15?,21-,22?,23+/m0/s1 |
| InChIKey | GJXRDBZNOREUBX-RJCWLEHASA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |