C27H34O4 — CID 91165403
butan-2-yl (5R,20R)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxylate (PubChem CID 91165403) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is butan-2-yl (5R,20R)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxylate.
| Compound Name | butan-2-yl (5R,20R)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxylate |
|---|---|
| PubChem CID | 91165403 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | butan-2-yl (5R,20R)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxylate |
| SMILES | CCC(C)OC(=O)[C@@H]1C=C2CC(=O)CCC2(C)C2=C1C1=CC[C@@]3(C)CCC(=O)C13CC2 |
| InChI | InChI=1S/C27H34O4/c1-5-16(2)31-24(30)19-15-17-14-18(28)6-12-26(17,4)20-8-13-27-21(23(19)20)7-10-25(27,3)11-9-22(27)29/h7,15-16,19H,5-6,8-14H2,1-4H3/t16?,19-,25+,26?,27?/m1/s1 |
| InChIKey | BAWPZAZHKDGLFA-RMGNQMSWSA-N |
| XLogP | 5.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|