C25H31NO3 — CID 90703493
(5R,9R,20R)-N,N,5,13-tetramethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxamide (PubChem CID 90703493) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (5R,9R,20R)-N,N,5,13-tetramethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxamide.
| Compound Name | (5R,9R,20R)-N,N,5,13-tetramethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxamide |
|---|---|
| PubChem CID | 90703493 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (5R,9R,20R)-N,N,5,13-tetramethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,18-triene-20-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C=C2CC(=O)CCC2(C)C2=C1C1=CC[C@@]3(C)CCC(=O)[C@@]13CC2 |
| InChI | InChI=1S/C25H31NO3/c1-23-9-6-19-21-17(22(29)26(3)4)14-15-13-16(27)5-11-24(15,2)18(21)7-12-25(19,23)20(28)8-10-23/h6,14,17H,5,7-13H2,1-4H3/t17-,23+,24?,25-/m1/s1 |
| InChIKey | YGUZRNLEBLDZIY-OSMDSLDNSA-N |
| XLogP | 4.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|