C23H26O4 — CID 70145554
(5S,13R,20S)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-20-carboxylic acid (PubChem CID 70145554) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (5S,13R,20S)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-20-carboxylic acid.
| Compound Name | (5S,13R,20S)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-20-carboxylic acid |
|---|---|
| PubChem CID | 70145554 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5S,13R,20S)-5,13-dimethyl-8,16-dioxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,17-triene-20-carboxylic acid |
| SMILES | C[C@@]12CCC(=O)C=C1C[C@H](C(=O)O)C1=C2CCC23C(=O)CC[C@@]2(C)CC=C13 |
| InChI | InChI=1S/C23H26O4/c1-21-7-4-17-19-15(20(26)27)12-13-11-14(24)3-9-22(13,2)16(19)5-10-23(17,21)18(25)6-8-21/h4,11,15H,3,5-10,12H2,1-2H3,(H,26,27)/t15-,21+,22+,23?/m0/s1 |
| InChIKey | NKVOIMMBANJWRQ-RBYOHLFASA-N |
| XLogP | 4.16 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |