C23H29IO4 — CID 163412318
13-iodosyl-10,17-dimethyl-3-oxo-17-propyl-2,6,7,11,12,16-hexahydro-1H-cyclopenta[a]phenanthrene-7-carboxylic acid (PubChem CID 163412318) has the molecular formula C23H29IO4 and a molecular weight of 496.39 g/mol. Its IUPAC name is 13-iodosyl-10,17-dimethyl-3-oxo-17-propyl-2,6,7,11,12,16-hexahydro-1H-cyclopenta[a]phenanthrene-7-carboxylic acid.
| Compound Name | 13-iodosyl-10,17-dimethyl-3-oxo-17-propyl-2,6,7,11,12,16-hexahydro-1H-cyclopenta[a]phenanthrene-7-carboxylic acid |
|---|---|
| PubChem CID | 163412318 |
| Molecular Formula | C23H29IO4 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 13-iodosyl-10,17-dimethyl-3-oxo-17-propyl-2,6,7,11,12,16-hexahydro-1H-cyclopenta[a]phenanthrene-7-carboxylic acid |
| SMILES | CCCC1(C)CC=C2C3=C(CCC21I=O)C1(C)CCC(=O)C=C1CC3C(=O)O |
| InChI | InChI=1S/C23H29IO4/c1-4-8-21(2)9-6-18-19-16(20(26)27)13-14-12-15(25)5-10-22(14,3)17(19)7-11-23(18,21)24-28/h6,12,16H,4-5,7-11,13H2,1-3H3,(H,26,27) |
| InChIKey | ABNNUQBIZQKEGU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|