C23H28O5 — CID 57114544
(7R,8S,10S,17R)-17-(2-carboxyethyl)-10,17-dimethyl-3-oxo-1,2,6,7,8,12,15,16-octahydrocyclopenta[a]phenanthrene-7-carboxylic acid (PubChem CID 57114544) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (7R,8S,10S,17R)-17-(2-carboxyethyl)-10,17-dimethyl-3-oxo-1,2,6,7,8,12,15,16-octahydrocyclopenta[a]phenanthrene-7-carboxylic acid.
| Compound Name | (7R,8S,10S,17R)-17-(2-carboxyethyl)-10,17-dimethyl-3-oxo-1,2,6,7,8,12,15,16-octahydrocyclopenta[a]phenanthrene-7-carboxylic acid |
|---|---|
| PubChem CID | 57114544 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (7R,8S,10S,17R)-17-(2-carboxyethyl)-10,17-dimethyl-3-oxo-1,2,6,7,8,12,15,16-octahydrocyclopenta[a]phenanthrene-7-carboxylic acid |
| SMILES | C[C@]1(CCC(=O)O)CCC2=C1CC=C1[C@H]2[C@H](C(=O)O)CC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C23H28O5/c1-22(9-7-19(25)26)8-6-15-17(22)3-4-18-20(15)16(21(27)28)12-13-11-14(24)5-10-23(13,18)2/h4,11,16,20H,3,5-10,12H2,1-2H3,(H,25,26)(H,27,28)/t16-,20-,22-,23+/m1/s1 |
| InChIKey | FGTPSHTXYWAGJB-NZILNVENSA-N |
| XLogP | 4.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|