C22H28IO2- — CID 154531977
CID 154531977 (PubChem CID 154531977) has the molecular formula C22H28IO2- and a molecular weight of 451.37 g/mol.
| Compound Name | CID 154531977 |
|---|---|
| PubChem CID | 154531977 |
| Molecular Formula | C22H28IO2- |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | — |
| SMILES | CC12CCC(=O)C=C1CCC1=C2CCC23[I-]C(O)CCC2(C)CC=C13 |
| InChI | InChI=1S/C22H28IO2/c1-20-9-6-18-16-4-3-14-13-15(24)5-11-21(14,2)17(16)7-12-22(18,20)23-19(25)8-10-20/h6,13,19,25H,3-5,7-12H2,1-2H3/q-1 |
| InChIKey | HDEYJYRIKZFEGW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|