C13H20O4S — CID 102215188
2-(7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl)ethyl methanesulfonate (PubChem CID 102215188) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-(7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl)ethyl methanesulfonate.
| Compound Name | 2-(7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 102215188 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC12CCCCC1=CC(=O)CC2 |
| InChI | InChI=1S/C13H20O4S/c1-18(15,16)17-9-8-13-6-3-2-4-11(13)10-12(14)5-7-13/h10H,2-9H2,1H3 |
| InChIKey | FILHGZRGGOYOAK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|