C22H32O8 — CID 11080386
tetramethyl (1Z,5Z)-3,7-di(propan-2-yl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylate (PubChem CID 11080386) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is tetramethyl (1Z,5Z)-3,7-di(propan-2-yl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylate.
| Compound Name | tetramethyl (1Z,5Z)-3,7-di(propan-2-yl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 11080386 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tetramethyl (1Z,5Z)-3,7-di(propan-2-yl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)C(C(C)C)C/C(C(=O)OC)=C(/C(=O)OC)C(C(C)C)C1 |
| InChI | InChI=1S/C22H32O8/c1-11(2)13-9-15(19(23)27-5)18(22(26)30-8)14(12(3)4)10-16(20(24)28-6)17(13)21(25)29-7/h11-14H,9-10H2,1-8H3/b17-16-,18-15- |
| InChIKey | AAMAYVOSVXRISR-IZEYCACRSA-N |
| XLogP | 2.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|