C11H18N2O5 — CID 143618860
methyl 4-[(1-hydroxy-3-methoxy-3-oxopropyl)amino]-1,2,3,6-tetrahydropyridine-5-carboxylate (PubChem CID 143618860) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl 4-[(1-hydroxy-3-methoxy-3-oxopropyl)amino]-1,2,3,6-tetrahydropyridine-5-carboxylate.
| Compound Name | methyl 4-[(1-hydroxy-3-methoxy-3-oxopropyl)amino]-1,2,3,6-tetrahydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 143618860 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | methyl 4-[(1-hydroxy-3-methoxy-3-oxopropyl)amino]-1,2,3,6-tetrahydropyridine-5-carboxylate |
| SMILES | COC(=O)CC(O)NC1=C(C(=O)OC)CNCC1 |
| InChI | InChI=1S/C11H18N2O5/c1-17-10(15)5-9(14)13-8-3-4-12-6-7(8)11(16)18-2/h9,12-14H,3-6H2,1-2H3 |
| InChIKey | LPKQSIKGBNFPPB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|