C10H21NO3S — CID 145044515
ethane;methanethiol;methyl 4-hydroxy-1,2,3,6-tetrahydropyridine-5-carboxylate (PubChem CID 145044515) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;methanethiol;methyl 4-hydroxy-1,2,3,6-tetrahydropyridine-5-carboxylate.
| Compound Name | ethane;methanethiol;methyl 4-hydroxy-1,2,3,6-tetrahydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 145044515 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethane;methanethiol;methyl 4-hydroxy-1,2,3,6-tetrahydropyridine-5-carboxylate |
| SMILES | CC.COC(=O)C1=C(O)CCNC1.CS |
| InChI | InChI=1S/C7H11NO3.C2H6.CH4S/c1-11-7(10)5-4-8-3-2-6(5)9;2*1-2/h8-9H,2-4H2,1H3;1-2H3;2H,1H3 |
| InChIKey | IODZILRZINUSTR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|