C14H14N2O3 — CID 110861160
N-(4-acetylphenyl)-4,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 110861160) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4,5-dimethyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4,5-dimethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110861160 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-(4-acetylphenyl)-4,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2noc(C)c2C)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-8-10(3)19-16-13(8)14(18)15-12-6-4-11(5-7-12)9(2)17/h4-7H,1-3H3,(H,15,18) |
| InChIKey | IWSWDDPWPUBBIA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |