C12H11N3O3 — CID 110392920
N-(4-acetylphenyl)-5-methyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110392920) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-methyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-5-methyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110392920 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(4-acetylphenyl)-5-methyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2nnc(C)o2)cc1 |
| InChI | InChI=1S/C12H11N3O3/c1-7(16)9-3-5-10(6-4-9)13-11(17)12-15-14-8(2)18-12/h3-6H,1-2H3,(H,13,17) |
| InChIKey | WJHBCQXLEZRCNA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |