C15H28N2O — CID 150808567
N-decyl-3,5-dimethyl-1,2-oxazol-4-amine (PubChem CID 150808567) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N-decyl-3,5-dimethyl-1,2-oxazol-4-amine.
| Compound Name | N-decyl-3,5-dimethyl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 150808567 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-decyl-3,5-dimethyl-1,2-oxazol-4-amine |
| SMILES | CCCCCCCCCCNc1c(C)noc1C |
| InChI | InChI=1S/C15H28N2O/c1-4-5-6-7-8-9-10-11-12-16-15-13(2)17-18-14(15)3/h16H,4-12H2,1-3H3 |
| InChIKey | KHKFGHDSUXRRPO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|