About 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole
5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole (PubChem CID 145438869) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole |
| PubChem CID | 145438869 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole |
| SMILES | C=C/C=C\c1onc(C)c1C |
| InChI | InChI=1S/C9H11NO/c1-4-5-6-9-7(2)8(3)10-11-9/h4-6H,1H2,2-3H3/b6-5- |
| InChIKey | CAGACZPGLMTEKX-WAYWQWQTSA-N |
| XLogP | 2.49 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole (CID 145438869) is 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole is C=C/C=C\c1onc(C)c1C.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole?
The InChIKey is CAGACZPGLMTEKX-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H11NO/c1-4-5-6-9-7(2)8(3)10-11-9/h4-6H,1H2,2-3H3/b6-5-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole?
5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole has a molecular weight of 149.19 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethyl-1,2-oxazole is sourced from PubChem (CID 145438869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).