C5H7NOS2 — CID 123958472
5-(disulfanyl)-3,4-dimethyl-1,2-oxazole (PubChem CID 123958472) has the molecular formula C5H7NOS2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 5-(disulfanyl)-3,4-dimethyl-1,2-oxazole.
| Compound Name | 5-(disulfanyl)-3,4-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 123958472 |
| Molecular Formula | C5H7NOS2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 5-(disulfanyl)-3,4-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(SS)c1C |
| InChI | InChI=1S/C5H7NOS2/c1-3-4(2)6-7-5(3)9-8/h8H,1-2H3 |
| InChIKey | QLANXIRDZNKEKA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|