C12H19NO3 — CID 151348234
3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,2-oxazole (PubChem CID 151348234) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 151348234 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,2-oxazole |
| SMILES | Cc1noc(C)c1C1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H19NO3/c1-7-9(8(2)16-13-7)10-14-11(3,4)12(5,6)15-10/h10H,1-6H3 |
| InChIKey | OLXUYFDOZJHDHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |