C11H18N2O3 — CID 162491525
2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxazolidine (PubChem CID 162491525) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxazolidine.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
|---|---|
| PubChem CID | 162491525 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
| SMILES | Cc1noc(C)c1N1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H18N2O3/c1-7-9(8(2)14-12-7)13-15-10(3,4)11(5,6)16-13/h1-6H3 |
| InChIKey | WWLVOYFNABRNGE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |