C13H10N2O3 — CID 118727406
2-(3,5-dimethyl-1,2-oxazol-4-yl)isoindole-1,3-dione (PubChem CID 118727406) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 118727406 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)isoindole-1,3-dione |
| SMILES | Cc1noc(C)c1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10N2O3/c1-7-11(8(2)18-14-7)15-12(16)9-5-3-4-6-10(9)13(15)17/h3-6H,1-2H3 |
| InChIKey | QNIJEBFITQCFAR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|