C18H18N2O5S — CID 8933462
(3,5-dimethyl-1,2-oxazol-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate (PubChem CID 8933462) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 8933462 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate |
| SMILES | CSC[C@@H](C(=O)OCc1c(C)noc1C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N2O5S/c1-10-14(11(2)25-19-10)8-24-18(23)15(9-26-3)20-16(21)12-6-4-5-7-13(12)17(20)22/h4-7,15H,8-9H2,1-3H3/t15-/m0/s1 |
| InChIKey | DQKAIEACSLNVBY-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|