C17H16N2O5S — CID 9063583
(5-methyl-1,2-oxazol-3-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate (PubChem CID 9063583) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 9063583 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropanoate |
| SMILES | CSC[C@H](C(=O)OCc1cc(C)on1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H16N2O5S/c1-10-7-11(18-24-10)8-23-17(22)14(9-25-2)19-15(20)12-5-3-4-6-13(12)16(19)21/h3-7,14H,8-9H2,1-2H3/t14-/m1/s1 |
| InChIKey | GIMDISDQNCTTQT-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|