C15H15NO6S — CID 10711970
methyl 2-[(2R)-1-methoxy-3-methylsulfanyl-1-oxopropan-2-yl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 10711970) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is methyl 2-[(2R)-1-methoxy-3-methylsulfanyl-1-oxopropan-2-yl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | methyl 2-[(2R)-1-methoxy-3-methylsulfanyl-1-oxopropan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 10711970 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | methyl 2-[(2R)-1-methoxy-3-methylsulfanyl-1-oxopropan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)N([C@@H](CSC)C(=O)OC)C2=O |
| InChI | InChI=1S/C15H15NO6S/c1-21-14(19)8-4-5-9-10(6-8)13(18)16(12(9)17)11(7-23-3)15(20)22-2/h4-6,11H,7H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZJDOABHKXCOPKF-NSHDSACASA-N |
| XLogP | 0.97 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|