C14H15NO4 — CID 59584622
(1R,2R,6S,7S)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 59584622) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 59584622 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (1R,2R,6S,7S)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1noc(C)c1C1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C14H15NO4/c1-5-9(6(2)19-15-5)12-13(16)10-7-3-4-8(18-7)11(10)14(12)17/h7-8,10-12H,3-4H2,1-2H3/t7-,8+,10+,11-,12? |
| InChIKey | HPQBDYCJXTUSCG-WSLGOKMXSA-N |
| XLogP | 1.32 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|