C5H5N3O — CID 90903187
5-amino-4-methyl-1,2-oxazole-3-carbonitrile (PubChem CID 90903187) has the molecular formula C5H5N3O and a molecular weight of 123.11 g/mol. Its IUPAC name is 5-amino-4-methyl-1,2-oxazole-3-carbonitrile.
| Compound Name | 5-amino-4-methyl-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 90903187 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 5-amino-4-methyl-1,2-oxazole-3-carbonitrile |
| SMILES | Cc1c(C#N)noc1N |
| InChI | InChI=1S/C5H5N3O/c1-3-4(2-6)8-9-5(3)7/h7H2,1H3 |
| InChIKey | RRTBTFRKIQMUNW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |