About 5-amino-4-methyl-1,2-oxazole-3-carbonitrile
5-amino-4-methyl-1,2-oxazole-3-carbonitrile (PubChem CID 90903187) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is 5-amino-4-methyl-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-4-methyl-1,2-oxazole-3-carbonitrile |
| PubChem CID | 90903187 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 5-amino-4-methyl-1,2-oxazole-3-carbonitrile |
| SMILES | Cc1c(C#N)noc1N |
| InChI | InChI=1S/C5H5N3O/c1-3-4(2-6)8-9-5(3)7/h7H2,1H3 |
| InChIKey | RRTBTFRKIQMUNW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-4-methyl-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methyl-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-amino-4-methyl-1,2-oxazole-3-carbonitrile (CID 90903187) is 5-amino-4-methyl-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-amino-4-methyl-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-amino-4-methyl-1,2-oxazole-3-carbonitrile is Cc1c(C#N)noc1N.
What is the InChIKey of 5-amino-4-methyl-1,2-oxazole-3-carbonitrile?
The InChIKey is RRTBTFRKIQMUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c1-3-4(2-6)8-9-5(3)7/h7H2,1H3.
What are the key properties of 5-amino-4-methyl-1,2-oxazole-3-carbonitrile?
5-amino-4-methyl-1,2-oxazole-3-carbonitrile has a molecular weight of 123.11 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methyl-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 90903187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).