About 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile
4-bromo-5-methyl-1,2-oxazole-3-carbonitrile (PubChem CID 116858984) has the molecular formula C5H3BrN2O
and a molecular weight of 187.00 g/mol. Its IUPAC name is 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile |
| PubChem CID | 116858984 |
| Molecular Formula | C5H3BrN2O |
| Molecular Weight | 187.00 g/mol |
| Exact Mass | 185.94 |
| IUPAC Name | 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile |
| SMILES | Cc1onc(C#N)c1Br |
| InChI | InChI=1S/C5H3BrN2O/c1-3-5(6)4(2-7)8-9-3/h1H3 |
| InChIKey | VCEKHKSAZLMAPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.00 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile?
The IUPAC name of 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile (CID 116858984) is 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile is Cc1onc(C#N)c1Br.
What is the InChIKey of 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile?
The InChIKey is VCEKHKSAZLMAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrN2O/c1-3-5(6)4(2-7)8-9-3/h1H3.
What are the key properties of 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile?
4-bromo-5-methyl-1,2-oxazole-3-carbonitrile has a molecular weight of 187.00 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 116858984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).