C5H3BrN2O — CID 116858984
4-bromo-5-methyl-1,2-oxazole-3-carbonitrile (PubChem CID 116858984) has the molecular formula C5H3BrN2O and a molecular weight of 187.00 g/mol. Its IUPAC name is 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile.
| Compound Name | 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 116858984 |
| Molecular Formula | C5H3BrN2O |
| Molecular Weight | 187.00 g/mol |
| Exact Mass | 185.94 |
| IUPAC Name | 4-bromo-5-methyl-1,2-oxazole-3-carbonitrile |
| SMILES | Cc1onc(C#N)c1Br |
| InChI | InChI=1S/C5H3BrN2O/c1-3-5(6)4(2-7)8-9-3/h1H3 |
| InChIKey | VCEKHKSAZLMAPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.00 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |