C12H5BrN2O2 — CID 116859112
5-(1-benzofuran-3-yl)-4-bromo-1,2-oxazole-3-carbonitrile (PubChem CID 116859112) has the molecular formula C12H5BrN2O2 and a molecular weight of 289.09 g/mol. Its IUPAC name is 5-(1-benzofuran-3-yl)-4-bromo-1,2-oxazole-3-carbonitrile.
| Compound Name | 5-(1-benzofuran-3-yl)-4-bromo-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 116859112 |
| Molecular Formula | C12H5BrN2O2 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 5-(1-benzofuran-3-yl)-4-bromo-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1noc(-c2coc3ccccc23)c1Br |
| InChI | InChI=1S/C12H5BrN2O2/c13-11-9(5-14)15-17-12(11)8-6-16-10-4-2-1-3-7(8)10/h1-4,6H |
| InChIKey | YOGAODWSTMWXAF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |