C12H6N2O2 — CID 116858958
5-(1-benzofuran-3-yl)-1,2-oxazole-3-carbonitrile (PubChem CID 116858958) has the molecular formula C12H6N2O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is 5-(1-benzofuran-3-yl)-1,2-oxazole-3-carbonitrile.
| Compound Name | 5-(1-benzofuran-3-yl)-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 116858958 |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5-(1-benzofuran-3-yl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2coc3ccccc23)on1 |
| InChI | InChI=1S/C12H6N2O2/c13-6-8-5-12(16-14-8)10-7-15-11-4-2-1-3-9(10)11/h1-5,7H |
| InChIKey | QQXJXTPNSOBNCY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |