C10H5IN2OS — CID 102618702
3-(1-benzofuran-3-yl)-5-iodo-1,2,4-thiadiazole (PubChem CID 102618702) has the molecular formula C10H5IN2OS and a molecular weight of 328.13 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-(1-benzofuran-3-yl)-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618702 |
| Molecular Formula | C10H5IN2OS |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-5-iodo-1,2,4-thiadiazole |
| SMILES | Ic1nc(-c2coc3ccccc23)ns1 |
| InChI | InChI=1S/C10H5IN2OS/c11-10-12-9(13-15-10)7-5-14-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | SLZZLCRFTDFICS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|