C12H8ClNOS — CID 116867872
4-(1-benzofuran-3-yl)-2-(chloromethyl)-1,3-thiazole (PubChem CID 116867872) has the molecular formula C12H8ClNOS and a molecular weight of 249.72 g/mol. Its IUPAC name is 4-(1-benzofuran-3-yl)-2-(chloromethyl)-1,3-thiazole.
| Compound Name | 4-(1-benzofuran-3-yl)-2-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116867872 |
| Molecular Formula | C12H8ClNOS |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 4-(1-benzofuran-3-yl)-2-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1nc(-c2coc3ccccc23)cs1 |
| InChI | InChI=1S/C12H8ClNOS/c13-5-12-14-10(7-16-12)9-6-15-11-4-2-1-3-8(9)11/h1-4,6-7H,5H2 |
| InChIKey | NWXBLYGHPFUCQK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|