C13H10N2O3S — CID 104527113
2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527113) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527113 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC(C(=O)O)c1csc(-c2coc3ccccc23)n1 |
| InChI | InChI=1S/C13H10N2O3S/c14-11(13(16)17)9-6-19-12(15-9)8-5-18-10-4-2-1-3-7(8)10/h1-6,11H,14H2,(H,16,17) |
| InChIKey | OYCUNIIUGJBAHD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |