About 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid
2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527113) has the molecular formula C13H10N2O3S
and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 104527113 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC(C(=O)O)c1csc(-c2coc3ccccc23)n1 |
| InChI | InChI=1S/C13H10N2O3S/c14-11(13(16)17)9-6-19-12(15-9)8-5-18-10-4-2-1-3-7(8)10/h1-6,11H,14H2,(H,16,17) |
| InChIKey | OYCUNIIUGJBAHD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid (CID 104527113) is 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid is NC(C(=O)O)c1csc(-c2coc3ccccc23)n1.
What is the InChIKey of 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is OYCUNIIUGJBAHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3S/c14-11(13(16)17)9-6-19-12(15-9)8-5-18-10-4-2-1-3-7(8)10/h1-6,11H,14H2,(H,16,17).
What are the key properties of 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid?
2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 274.30 g/mol, XLogP of 2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-(1-benzofuran-3-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 104527113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).