C9H8N2O2S2 — CID 104527084
2-amino-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid (PubChem CID 104527084) has the molecular formula C9H8N2O2S2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-amino-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-amino-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 104527084 |
| Molecular Formula | C9H8N2O2S2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 2-amino-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid |
| SMILES | NC(C(=O)O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C9H8N2O2S2/c10-7(9(12)13)6-4-15-8(11-6)5-1-2-14-3-5/h1-4,7H,10H2,(H,12,13) |
| InChIKey | MOMXUPLILVUYEN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |