C14H16N2O2S — CID 104527032
2-amino-2-[2-(2,4,6-trimethylphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104527032) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-amino-2-[2-(2,4,6-trimethylphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(2,4,6-trimethylphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104527032 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-amino-2-[2-(2,4,6-trimethylphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1cc(C)c(-c2nc(C(N)C(=O)O)cs2)c(C)c1 |
| InChI | InChI=1S/C14H16N2O2S/c1-7-4-8(2)11(9(3)5-7)13-16-10(6-19-13)12(15)14(17)18/h4-6,12H,15H2,1-3H3,(H,17,18) |
| InChIKey | GEWDQZYTQDYIEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |