C11H13NS2 — CID 115686479
4-butan-2-yl-2-thiophen-3-yl-1,3-thiazole (PubChem CID 115686479) has the molecular formula C11H13NS2 and a molecular weight of 223.37 g/mol. Its IUPAC name is 4-butan-2-yl-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-butan-2-yl-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 115686479 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-butan-2-yl-2-thiophen-3-yl-1,3-thiazole |
| SMILES | CCC(C)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H13NS2/c1-3-8(2)10-7-14-11(12-10)9-4-5-13-6-9/h4-8H,3H2,1-2H3 |
| InChIKey | IYIGASZJVFYIKR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |