C11H15N3S — CID 112697822
4-butan-2-yl-2-(1-methylpyrazol-4-yl)-1,3-thiazole (PubChem CID 112697822) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-butan-2-yl-2-(1-methylpyrazol-4-yl)-1,3-thiazole.
| Compound Name | 4-butan-2-yl-2-(1-methylpyrazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 112697822 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-butan-2-yl-2-(1-methylpyrazol-4-yl)-1,3-thiazole |
| SMILES | CCC(C)c1csc(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C11H15N3S/c1-4-8(2)10-7-15-11(13-10)9-5-12-14(3)6-9/h5-8H,4H2,1-3H3 |
| InChIKey | QRZSGUZZVQWEFV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |