C12H15NS2 — CID 115686489
4-butan-2-yl-2-(thiophen-2-ylmethyl)-1,3-thiazole (PubChem CID 115686489) has the molecular formula C12H15NS2 and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-butan-2-yl-2-(thiophen-2-ylmethyl)-1,3-thiazole.
| Compound Name | 4-butan-2-yl-2-(thiophen-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 115686489 |
| Molecular Formula | C12H15NS2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-butan-2-yl-2-(thiophen-2-ylmethyl)-1,3-thiazole |
| SMILES | CCC(C)c1csc(Cc2cccs2)n1 |
| InChI | InChI=1S/C12H15NS2/c1-3-9(2)11-8-15-12(13-11)7-10-5-4-6-14-10/h4-6,8-9H,3,7H2,1-2H3 |
| InChIKey | NKOQEKWXHDDBHJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |