C13H10N2O2S — CID 116887739
2-(1-benzofuran-3-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 116887739) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(1-benzofuran-3-yl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116887739 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2coc3ccccc23)sc1C(N)=O |
| InChI | InChI=1S/C13H10N2O2S/c1-7-11(12(14)16)18-13(15-7)9-6-17-10-5-3-2-4-8(9)10/h2-6H,1H3,(H2,14,16) |
| InChIKey | SOSBTNUPPGZIBT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |