C13H9NO2S — CID 116867313
4-(1-benzofuran-3-yl)-5-methyl-1,3-thiazole-2-carbaldehyde (PubChem CID 116867313) has the molecular formula C13H9NO2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-(1-benzofuran-3-yl)-5-methyl-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-(1-benzofuran-3-yl)-5-methyl-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 116867313 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 4-(1-benzofuran-3-yl)-5-methyl-1,3-thiazole-2-carbaldehyde |
| SMILES | Cc1sc(C=O)nc1-c1coc2ccccc12 |
| InChI | InChI=1S/C13H9NO2S/c1-8-13(14-12(6-15)17-8)10-7-16-11-5-3-2-4-9(10)11/h2-7H,1H3 |
| InChIKey | PPGTXYZTDPUVEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|